C12H16N2O2S — CID 3034591
8,9,11-trimethyl-3-sulfanylidene-2,4-diazaspiro[5.5]undec-8-ene-1,5-dione (PubChem CID 3034591) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 8,9,11-trimethyl-3-sulfanylidene-2,4-diazaspiro[5.5]undec-8-ene-1,5-dione.
| Compound Name | 8,9,11-trimethyl-3-sulfanylidene-2,4-diazaspiro[5.5]undec-8-ene-1,5-dione |
|---|---|
| PubChem CID | 3034591 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 8,9,11-trimethyl-3-sulfanylidene-2,4-diazaspiro[5.5]undec-8-ene-1,5-dione |
| SMILES | CC1=C(C)CC2(C(=O)NC(=S)NC2=O)C(C)C1 |
| InChI | InChI=1S/C12H16N2O2S/c1-6-4-8(3)12(5-7(6)2)9(15)13-11(17)14-10(12)16/h8H,4-5H2,1-3H3,(H2,13,14,15,16,17) |
| InChIKey | MPUNOTZOFTXVOA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|