C11H21NO2 — CID 3034673
2,2-dimethylpropyl (E)-3-(dimethylamino)-2-methylprop-2-enoate (PubChem CID 3034673) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 2,2-dimethylpropyl (E)-3-(dimethylamino)-2-methylprop-2-enoate.
| Compound Name | 2,2-dimethylpropyl (E)-3-(dimethylamino)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 3034673 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 2,2-dimethylpropyl (E)-3-(dimethylamino)-2-methylprop-2-enoate |
| SMILES | C/C(=C\N(C)C)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C11H21NO2/c1-9(7-12(5)6)10(13)14-8-11(2,3)4/h7H,8H2,1-6H3/b9-7+ |
| InChIKey | IHQMRUJSOWFBKS-VQHVLOKHSA-N |
| XLogP | 2.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|