About 3H-1,3-benzothiazole-2-thione;N,N-diethylethanamine
3H-1,3-benzothiazole-2-thione;N,N-diethylethanamine (PubChem CID 3034710) has the molecular formula C13H20N2S2
and a molecular weight of 268.45 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;N,N-diethylethanamine.
Molecular Properties
| Compound Name | 3H-1,3-benzothiazole-2-thione;N,N-diethylethanamine |
| PubChem CID | 3034710 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.S=c1[nH]c2ccccc2s1 |
| InChI | InChI=1S/C7H5NS2.C6H15N/c9-7-8-5-3-1-2-4-6(5)10-7;1-4-7(5-2)6-3/h1-4H,(H,8,9);4-6H2,1-3H3 |
| InChIKey | DVUKIEBZAXCCAA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3H-1,3-benzothiazole-2-thione;N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1,3-benzothiazole-2-thione;N,N-diethylethanamine?
The IUPAC name of 3H-1,3-benzothiazole-2-thione;N,N-diethylethanamine (CID 3034710) is 3H-1,3-benzothiazole-2-thione;N,N-diethylethanamine.
What is the SMILES notation for 3H-1,3-benzothiazole-2-thione;N,N-diethylethanamine?
The canonical SMILES for 3H-1,3-benzothiazole-2-thione;N,N-diethylethanamine is CCN(CC)CC.S=c1[nH]c2ccccc2s1.
What is the InChIKey of 3H-1,3-benzothiazole-2-thione;N,N-diethylethanamine?
The InChIKey is DVUKIEBZAXCCAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS2.C6H15N/c9-7-8-5-3-1-2-4-6(5)10-7;1-4-7(5-2)6-3/h1-4H,(H,8,9);4-6H2,1-3H3.
What are the key properties of 3H-1,3-benzothiazole-2-thione;N,N-diethylethanamine?
3H-1,3-benzothiazole-2-thione;N,N-diethylethanamine has a molecular weight of 268.45 g/mol, XLogP of 4.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1,3-benzothiazole-2-thione;N,N-diethylethanamine is sourced from PubChem (CID 3034710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).