C26H28Cl2N4O4S — CID 3034779
2-[5,6-dichloro-3-ethyl-2-[3-(3-ethyl-5,6-dimethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]benzimidazol-1-yl]-N-methylsulfonylethanimidate (PubChem CID 3034779) has the molecular formula C26H28Cl2N4O4S and a molecular weight of 563.51 g/mol. Its IUPAC name is 2-[5,6-dichloro-3-ethyl-2-[3-(3-ethyl-5,6-dimethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]benzimidazol-1-yl]-N-methylsulfonylethanimidate.
| Compound Name | 2-[5,6-dichloro-3-ethyl-2-[3-(3-ethyl-5,6-dimethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]benzimidazol-1-yl]-N-methylsulfonylethanimidate |
|---|---|
| PubChem CID | 3034779 |
| Molecular Formula | C26H28Cl2N4O4S |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | 2-[5,6-dichloro-3-ethyl-2-[3-(3-ethyl-5,6-dimethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]benzimidazol-1-yl]-N-methylsulfonylethanimidate |
| SMILES | CCN1C(=CC=Cc2oc3cc(C)c(C)cc3[n+]2CC)N(CC([O-])=NS(C)(=O)=O)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C26H28Cl2N4O4S/c1-6-30-20-13-18(27)19(28)14-21(20)32(15-24(33)29-37(5,34)35)25(30)9-8-10-26-31(7-2)22-11-16(3)17(4)12-23(22)36-26/h8-14H,6-7,15H2,1-5H3 |
| InChIKey | HLGNZINTQLBFME-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|