About 1-ethyldibenzothiophene
1-ethyldibenzothiophene (PubChem CID 3034805) has the molecular formula C14H12S
and a molecular weight of 212.32 g/mol. Its IUPAC name is 1-ethyldibenzothiophene.
Molecular Properties
| Compound Name | 1-ethyldibenzothiophene |
| PubChem CID | 3034805 |
| Molecular Formula | C14H12S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 1-ethyldibenzothiophene |
| SMILES | CCc1cccc2sc3ccccc3c12 |
| InChI | InChI=1S/C14H12S/c1-2-10-6-5-9-13-14(10)11-7-3-4-8-12(11)15-13/h3-9H,2H2,1H3 |
| InChIKey | IEFPJOMUXITDSC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyldibenzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyldibenzothiophene?
The IUPAC name of 1-ethyldibenzothiophene (CID 3034805) is 1-ethyldibenzothiophene.
What is the SMILES notation for 1-ethyldibenzothiophene?
The canonical SMILES for 1-ethyldibenzothiophene is CCc1cccc2sc3ccccc3c12.
What is the InChIKey of 1-ethyldibenzothiophene?
The InChIKey is IEFPJOMUXITDSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12S/c1-2-10-6-5-9-13-14(10)11-7-3-4-8-12(11)15-13/h3-9H,2H2,1H3.
What are the key properties of 1-ethyldibenzothiophene?
1-ethyldibenzothiophene has a molecular weight of 212.32 g/mol, XLogP of 4.62, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyldibenzothiophene is sourced from PubChem (CID 3034805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).