C34H72NO4P — CID 3034854
bis(2-ethylhexyl) hydrogen phosphate;octadec-9-en-1-amine (PubChem CID 3034854) has the molecular formula C34H72NO4P and a molecular weight of 589.93 g/mol. Its IUPAC name is bis(2-ethylhexyl) hydrogen phosphate;octadec-9-en-1-amine.
| Compound Name | bis(2-ethylhexyl) hydrogen phosphate;octadec-9-en-1-amine |
|---|---|
| PubChem CID | 3034854 |
| Molecular Formula | C34H72NO4P |
| Molecular Weight | 589.93 g/mol |
| Exact Mass | 589.52 |
| IUPAC Name | bis(2-ethylhexyl) hydrogen phosphate;octadec-9-en-1-amine |
| SMILES | CCCCC(CC)COP(=O)(O)OCC(CC)CCCC.CCCCCCCCC=CCCCCCCCCN |
| InChI | InChI=1S/C18H37N.C16H35O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-5-9-11-15(7-3)13-19-21(17,18)20-14-16(8-4)12-10-6-2/h9-10H,2-8,11-19H2,1H3;15-16H,5-14H2,1-4H3,(H,17,18) |
| InChIKey | IXJZJRRYKPCXHG-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.93 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|