About (2,6-dimethoxyphenyl) (2R)-2-morpholin-4-ylpropanoate;hydrochloride
(2,6-dimethoxyphenyl) (2R)-2-morpholin-4-ylpropanoate;hydrochloride (PubChem CID 3034965) has the molecular formula C15H22ClNO5
and a molecular weight of 331.80 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl) (2R)-2-morpholin-4-ylpropanoate;hydrochloride.
Molecular Properties
| Compound Name | (2,6-dimethoxyphenyl) (2R)-2-morpholin-4-ylpropanoate;hydrochloride |
| PubChem CID | 3034965 |
| Molecular Formula | C15H22ClNO5 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (2,6-dimethoxyphenyl) (2R)-2-morpholin-4-ylpropanoate;hydrochloride |
| SMILES | COc1cccc(OC)c1OC(=O)[C@@H](C)N1CCOCC1.Cl |
| InChI | InChI=1S/C15H21NO5.ClH/c1-11(16-7-9-20-10-8-16)15(17)21-14-12(18-2)5-4-6-13(14)19-3;/h4-6,11H,7-10H2,1-3H3;1H/t11-;/m1./s1 |
| InChIKey | WOMVMPNQSSOFPY-RFVHGSKJSA-N |
| XLogP | 1.75 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dimethoxyphenyl) (2R)-2-morpholin-4-ylpropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethoxyphenyl) (2R)-2-morpholin-4-ylpropanoate;hydrochloride?
The IUPAC name of (2,6-dimethoxyphenyl) (2R)-2-morpholin-4-ylpropanoate;hydrochloride (CID 3034965) is (2,6-dimethoxyphenyl) (2R)-2-morpholin-4-ylpropanoate;hydrochloride.
What is the SMILES notation for (2,6-dimethoxyphenyl) (2R)-2-morpholin-4-ylpropanoate;hydrochloride?
The canonical SMILES for (2,6-dimethoxyphenyl) (2R)-2-morpholin-4-ylpropanoate;hydrochloride is COc1cccc(OC)c1OC(=O)[C@@H](C)N1CCOCC1.Cl.
What is the InChIKey of (2,6-dimethoxyphenyl) (2R)-2-morpholin-4-ylpropanoate;hydrochloride?
The InChIKey is WOMVMPNQSSOFPY-RFVHGSKJSA-N. The full InChI is InChI=1S/C15H21NO5.ClH/c1-11(16-7-9-20-10-8-16)15(17)21-14-12(18-2)5-4-6-13(14)19-3;/h4-6,11H,7-10H2,1-3H3;1H/t11-;/m1./s1.
What are the key properties of (2,6-dimethoxyphenyl) (2R)-2-morpholin-4-ylpropanoate;hydrochloride?
(2,6-dimethoxyphenyl) (2R)-2-morpholin-4-ylpropanoate;hydrochloride has a molecular weight of 331.80 g/mol, XLogP of 1.75, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethoxyphenyl) (2R)-2-morpholin-4-ylpropanoate;hydrochloride is sourced from PubChem (CID 3034965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).