C22H23NO2 — CID 30349918
N-[2-(3,5-dimethylphenoxy)ethyl]-2-naphthalen-1-ylacetamide (PubChem CID 30349918) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 30349918 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]-2-naphthalen-1-ylacetamide |
| SMILES | Cc1cc(C)cc(OCCNC(=O)Cc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C22H23NO2/c1-16-12-17(2)14-20(13-16)25-11-10-23-22(24)15-19-8-5-7-18-6-3-4-9-21(18)19/h3-9,12-14H,10-11,15H2,1-2H3,(H,23,24) |
| InChIKey | CNXHIZUUZDZOIK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|