About 1,1-dioxo-1,2-benzothiazole-3-thione
1,1-dioxo-1,2-benzothiazole-3-thione (PubChem CID 3035171) has the molecular formula C7H5NO2S2
and a molecular weight of 199.26 g/mol. Its IUPAC name is 1,1-dioxo-1,2-benzothiazole-3-thione.
Molecular Properties
| Compound Name | 1,1-dioxo-1,2-benzothiazole-3-thione |
| PubChem CID | 3035171 |
| Molecular Formula | C7H5NO2S2 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 198.98 |
| IUPAC Name | 1,1-dioxo-1,2-benzothiazole-3-thione |
| SMILES | O=S1(=O)NC(=S)c2ccccc21 |
| InChI | InChI=1S/C7H5NO2S2/c9-12(10)6-4-2-1-3-5(6)7(11)8-12/h1-4H,(H,8,11) |
| InChIKey | BAVQVWLILLHJKA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dioxo-1,2-benzothiazole-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-1,2-benzothiazole-3-thione?
The IUPAC name of 1,1-dioxo-1,2-benzothiazole-3-thione (CID 3035171) is 1,1-dioxo-1,2-benzothiazole-3-thione.
What is the SMILES notation for 1,1-dioxo-1,2-benzothiazole-3-thione?
The canonical SMILES for 1,1-dioxo-1,2-benzothiazole-3-thione is O=S1(=O)NC(=S)c2ccccc21.
What is the InChIKey of 1,1-dioxo-1,2-benzothiazole-3-thione?
The InChIKey is BAVQVWLILLHJKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO2S2/c9-12(10)6-4-2-1-3-5(6)7(11)8-12/h1-4H,(H,8,11).
What are the key properties of 1,1-dioxo-1,2-benzothiazole-3-thione?
1,1-dioxo-1,2-benzothiazole-3-thione has a molecular weight of 199.26 g/mol, XLogP of 0.65, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-1,2-benzothiazole-3-thione is sourced from PubChem (CID 3035171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).