C10H16N4O2 — CID 3035271
3-N,3-N,5-N,5-N,1-pentamethylpyrazole-3,5-dicarboxamide (PubChem CID 3035271) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-N,3-N,5-N,5-N,1-pentamethylpyrazole-3,5-dicarboxamide.
| Compound Name | 3-N,3-N,5-N,5-N,1-pentamethylpyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 3035271 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-N,3-N,5-N,5-N,1-pentamethylpyrazole-3,5-dicarboxamide |
| SMILES | CN(C)C(=O)c1cc(C(=O)N(C)C)n(C)n1 |
| InChI | InChI=1S/C10H16N4O2/c1-12(2)9(15)7-6-8(14(5)11-7)10(16)13(3)4/h6H,1-5H3 |
| InChIKey | XGQCQNGYWVWVKE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |