C7H10Cl3F2O4P — CID 3035295
diethyl [(Z)-1,3,3-trichloro-1,3-difluoroprop-1-en-2-yl] phosphate (PubChem CID 3035295) has the molecular formula C7H10Cl3F2O4P and a molecular weight of 333.48 g/mol. Its IUPAC name is diethyl [(Z)-1,3,3-trichloro-1,3-difluoroprop-1-en-2-yl] phosphate.
| Compound Name | diethyl [(Z)-1,3,3-trichloro-1,3-difluoroprop-1-en-2-yl] phosphate |
|---|---|
| PubChem CID | 3035295 |
| Molecular Formula | C7H10Cl3F2O4P |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | diethyl [(Z)-1,3,3-trichloro-1,3-difluoroprop-1-en-2-yl] phosphate |
| SMILES | CCOP(=O)(OCC)O/C(=C(/F)Cl)C(F)(Cl)Cl |
| InChI | InChI=1S/C7H10Cl3F2O4P/c1-3-14-17(13,15-4-2)16-5(6(8)11)7(9,10)12/h3-4H2,1-2H3/b6-5+ |
| InChIKey | CGLZJPKGIUUKDV-AATRIKPKSA-N |
| XLogP | 4.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|