C10H12Na2O5 — CID 3035329
disodium;(1S,2S,3R,4R)-2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 3035329) has the molecular formula C10H12Na2O5 and a molecular weight of 258.18 g/mol. Its IUPAC name is disodium;(1S,2S,3R,4R)-2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | disodium;(1S,2S,3R,4R)-2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 3035329 |
| Molecular Formula | C10H12Na2O5 |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | disodium;(1S,2S,3R,4R)-2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | C[C@]1(C(=O)[O-])[C@H]2CC[C@H](O2)[C@@]1(C)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C10H14O5.2Na/c1-9(7(11)12)5-3-4-6(15-5)10(9,2)8(13)14;;/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14);;/q;2*+1/p-2/t5-,6+,9-,10+;; |
| InChIKey | JFALSOLNDKMHAL-AURYQDOYSA-L |
| XLogP | -7.93 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | -7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |