C6H10O7 — CID 3035456
(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid (PubChem CID 3035456) has the molecular formula C6H10O7 and a molecular weight of 194.14 g/mol. Its IUPAC name is (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid.
| Compound Name | (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid |
|---|---|
| PubChem CID | 3035456 |
| Molecular Formula | C6H10O7 |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid |
| SMILES | O=C(O)C(=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-4,7-10H,1H2,(H,12,13)/t2-,3-,4+/m1/s1 |
| InChIKey | VBUYCZFBVCCYFD-JJYYJPOSSA-N |
| XLogP | -3.28 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|