(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid

C6H10O7 — CID 3035456

IUPAC(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid
SMILESO=C(O)C(=O)[C@@H](O)[C@H](O)[C@H](O)CO
InChIInChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-4,7-10H,1H2,(H,12,13)/t2-,3-,4+/m1/s1
InChIKeyVBUYCZFBVCCYFD-JJYYJPOSSA-N
MW194.14 g/mol
LogP-3.28
Rot. Bonds5

About (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid

(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid (PubChem CID 3035456) has the molecular formula C6H10O7 and a molecular weight of 194.14 g/mol. Its IUPAC name is (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid.

Molecular Properties

Compound Name(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid
PubChem CID3035456
Molecular FormulaC6H10O7
Molecular Weight194.14 g/mol
Exact Mass194.04
IUPAC Name(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid
SMILESO=C(O)C(=O)[C@@H](O)[C@H](O)[C@H](O)CO
InChIInChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-4,7-10H,1H2,(H,12,13)/t2-,3-,4+/m1/s1
InChIKeyVBUYCZFBVCCYFD-JJYYJPOSSA-N
XLogP-3.28
TPSA135.29 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.14
LogP ≤ 5-3.28
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid?
The IUPAC name of (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid (CID 3035456) is (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid.
What is the SMILES notation for (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid?
The canonical SMILES for (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid is O=C(O)C(=O)[C@@H](O)[C@H](O)[C@H](O)CO.
What is the InChIKey of (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid?
The InChIKey is VBUYCZFBVCCYFD-JJYYJPOSSA-N. The full InChI is InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-4,7-10H,1H2,(H,12,13)/t2-,3-,4+/m1/s1.
What are the key properties of (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid?
(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid has a molecular weight of 194.14 g/mol, XLogP of -3.28, 5 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid is sourced from PubChem (CID 3035456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).