About 7-phenylmethoxyquinoline
7-phenylmethoxyquinoline (PubChem CID 3035604) has the molecular formula C16H13NO
and a molecular weight of 235.29 g/mol. Its IUPAC name is 7-phenylmethoxyquinoline.
Molecular Properties
| Compound Name | 7-phenylmethoxyquinoline |
| PubChem CID | 3035604 |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 7-phenylmethoxyquinoline |
| SMILES | c1ccc(COc2ccc3cccnc3c2)cc1 |
| InChI | InChI=1S/C16H13NO/c1-2-5-13(6-3-1)12-18-15-9-8-14-7-4-10-17-16(14)11-15/h1-11H,12H2 |
| InChIKey | SIDLHXXVIBTSJZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-phenylmethoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenylmethoxyquinoline?
The IUPAC name of 7-phenylmethoxyquinoline (CID 3035604) is 7-phenylmethoxyquinoline.
What is the SMILES notation for 7-phenylmethoxyquinoline?
The canonical SMILES for 7-phenylmethoxyquinoline is c1ccc(COc2ccc3cccnc3c2)cc1.
What is the InChIKey of 7-phenylmethoxyquinoline?
The InChIKey is SIDLHXXVIBTSJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO/c1-2-5-13(6-3-1)12-18-15-9-8-14-7-4-10-17-16(14)11-15/h1-11H,12H2.
What are the key properties of 7-phenylmethoxyquinoline?
7-phenylmethoxyquinoline has a molecular weight of 235.29 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenylmethoxyquinoline is sourced from PubChem (CID 3035604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).