About N-(2,3-dimethylimidazol-4-yl)-N-hydroxyacetamide
N-(2,3-dimethylimidazol-4-yl)-N-hydroxyacetamide (PubChem CID 3035957) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is N-(2,3-dimethylimidazol-4-yl)-N-hydroxyacetamide.
Molecular Properties
| Compound Name | N-(2,3-dimethylimidazol-4-yl)-N-hydroxyacetamide |
| PubChem CID | 3035957 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | N-(2,3-dimethylimidazol-4-yl)-N-hydroxyacetamide |
| SMILES | CC(=O)N(O)c1cnc(C)n1C |
| InChI | InChI=1S/C7H11N3O2/c1-5-8-4-7(9(5)3)10(12)6(2)11/h4,12H,1-3H3 |
| InChIKey | WTQHZEPQFDBZCI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,3-dimethylimidazol-4-yl)-N-hydroxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dimethylimidazol-4-yl)-N-hydroxyacetamide?
The IUPAC name of N-(2,3-dimethylimidazol-4-yl)-N-hydroxyacetamide (CID 3035957) is N-(2,3-dimethylimidazol-4-yl)-N-hydroxyacetamide.
What is the SMILES notation for N-(2,3-dimethylimidazol-4-yl)-N-hydroxyacetamide?
The canonical SMILES for N-(2,3-dimethylimidazol-4-yl)-N-hydroxyacetamide is CC(=O)N(O)c1cnc(C)n1C.
What is the InChIKey of N-(2,3-dimethylimidazol-4-yl)-N-hydroxyacetamide?
The InChIKey is WTQHZEPQFDBZCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-5-8-4-7(9(5)3)10(12)6(2)11/h4,12H,1-3H3.
What are the key properties of N-(2,3-dimethylimidazol-4-yl)-N-hydroxyacetamide?
N-(2,3-dimethylimidazol-4-yl)-N-hydroxyacetamide has a molecular weight of 169.18 g/mol, XLogP of 0.47, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dimethylimidazol-4-yl)-N-hydroxyacetamide is sourced from PubChem (CID 3035957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).