About N-(2-hydroxyethyl)-3,3-bis(methylsulfanyl)propanamide
N-(2-hydroxyethyl)-3,3-bis(methylsulfanyl)propanamide (PubChem CID 3035981) has the molecular formula C7H15NO2S2
and a molecular weight of 209.34 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-3,3-bis(methylsulfanyl)propanamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-3,3-bis(methylsulfanyl)propanamide |
| PubChem CID | 3035981 |
| Molecular Formula | C7H15NO2S2 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | N-(2-hydroxyethyl)-3,3-bis(methylsulfanyl)propanamide |
| SMILES | CSC(CC(=O)NCCO)SC |
| InChI | InChI=1S/C7H15NO2S2/c1-11-7(12-2)5-6(10)8-3-4-9/h7,9H,3-5H2,1-2H3,(H,8,10) |
| InChIKey | YACJUWJRBSAQIG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxyethyl)-3,3-bis(methylsulfanyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-3,3-bis(methylsulfanyl)propanamide?
The IUPAC name of N-(2-hydroxyethyl)-3,3-bis(methylsulfanyl)propanamide (CID 3035981) is N-(2-hydroxyethyl)-3,3-bis(methylsulfanyl)propanamide.
What is the SMILES notation for N-(2-hydroxyethyl)-3,3-bis(methylsulfanyl)propanamide?
The canonical SMILES for N-(2-hydroxyethyl)-3,3-bis(methylsulfanyl)propanamide is CSC(CC(=O)NCCO)SC.
What is the InChIKey of N-(2-hydroxyethyl)-3,3-bis(methylsulfanyl)propanamide?
The InChIKey is YACJUWJRBSAQIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2S2/c1-11-7(12-2)5-6(10)8-3-4-9/h7,9H,3-5H2,1-2H3,(H,8,10).
What are the key properties of N-(2-hydroxyethyl)-3,3-bis(methylsulfanyl)propanamide?
N-(2-hydroxyethyl)-3,3-bis(methylsulfanyl)propanamide has a molecular weight of 209.34 g/mol, XLogP of 0.54, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-3,3-bis(methylsulfanyl)propanamide is sourced from PubChem (CID 3035981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).