About 2-(2-methylpropylamino)-1,2-diphenylethanol
2-(2-methylpropylamino)-1,2-diphenylethanol (PubChem CID 3036007) has the molecular formula C18H23NO
and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-(2-methylpropylamino)-1,2-diphenylethanol.
Molecular Properties
| Compound Name | 2-(2-methylpropylamino)-1,2-diphenylethanol |
| PubChem CID | 3036007 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 2-(2-methylpropylamino)-1,2-diphenylethanol |
| SMILES | CC(C)CNC(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C18H23NO/c1-14(2)13-19-17(15-9-5-3-6-10-15)18(20)16-11-7-4-8-12-16/h3-12,14,17-20H,13H2,1-2H3 |
| InChIKey | AFUDNVRZGPHSQO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-methylpropylamino)-1,2-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropylamino)-1,2-diphenylethanol?
The IUPAC name of 2-(2-methylpropylamino)-1,2-diphenylethanol (CID 3036007) is 2-(2-methylpropylamino)-1,2-diphenylethanol.
What is the SMILES notation for 2-(2-methylpropylamino)-1,2-diphenylethanol?
The canonical SMILES for 2-(2-methylpropylamino)-1,2-diphenylethanol is CC(C)CNC(c1ccccc1)C(O)c1ccccc1.
What is the InChIKey of 2-(2-methylpropylamino)-1,2-diphenylethanol?
The InChIKey is AFUDNVRZGPHSQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO/c1-14(2)13-19-17(15-9-5-3-6-10-15)18(20)16-11-7-4-8-12-16/h3-12,14,17-20H,13H2,1-2H3.
What are the key properties of 2-(2-methylpropylamino)-1,2-diphenylethanol?
2-(2-methylpropylamino)-1,2-diphenylethanol has a molecular weight of 269.39 g/mol, XLogP of 3.71, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropylamino)-1,2-diphenylethanol is sourced from PubChem (CID 3036007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).