C18H22N4O4S3 — CID 30360225
2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole (PubChem CID 30360225) has the molecular formula C18H22N4O4S3 and a molecular weight of 454.60 g/mol. Its IUPAC name is 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 30360225 |
| Molecular Formula | C18H22N4O4S3 |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole |
| SMILES | CCCCSc1nnc(SCc2nnc(-c3cc(OC)c(OC)c(OC)c3)o2)s1 |
| InChI | InChI=1S/C18H22N4O4S3/c1-5-6-7-27-17-21-22-18(29-17)28-10-14-19-20-16(26-14)11-8-12(23-2)15(25-4)13(9-11)24-3/h8-9H,5-7,10H2,1-4H3 |
| InChIKey | RCSXWFVVBWHCBJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 92.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|