C26H32N2O10 — CID 3036111
3-[3-[4-[5-(2-carboxyethyl)-2-hydroxyphenyl]-1,4-bis(carboxymethylamino)butyl]-4-hydroxyphenyl]propanoic acid (PubChem CID 3036111) has the molecular formula C26H32N2O10 and a molecular weight of 532.55 g/mol. Its IUPAC name is 3-[3-[4-[5-(2-carboxyethyl)-2-hydroxyphenyl]-1,4-bis(carboxymethylamino)butyl]-4-hydroxyphenyl]propanoic acid.
| Compound Name | 3-[3-[4-[5-(2-carboxyethyl)-2-hydroxyphenyl]-1,4-bis(carboxymethylamino)butyl]-4-hydroxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 3036111 |
| Molecular Formula | C26H32N2O10 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 3-[3-[4-[5-(2-carboxyethyl)-2-hydroxyphenyl]-1,4-bis(carboxymethylamino)butyl]-4-hydroxyphenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(O)c(C(CCC(NCC(=O)O)c2cc(CCC(=O)O)ccc2O)NCC(=O)O)c1 |
| InChI | InChI=1S/C26H32N2O10/c29-21-7-1-15(3-9-23(31)32)11-17(21)19(27-13-25(35)36)5-6-20(28-14-26(37)38)18-12-16(2-8-22(18)30)4-10-24(33)34/h1-2,7-8,11-12,19-20,27-30H,3-6,9-10,13-14H2,(H,31,32)(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | DDNZVAQYZBXDOP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 213.72 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|