About [1-(3,4-dimethylphenyl)-1-phenylprop-2-ynyl] N-cyclohexylcarbamate
[1-(3,4-dimethylphenyl)-1-phenylprop-2-ynyl] N-cyclohexylcarbamate (PubChem CID 30362) has the molecular formula C24H27NO2
and a molecular weight of 361.49 g/mol. Its IUPAC name is [1-(3,4-dimethylphenyl)-1-phenylprop-2-ynyl] N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | [1-(3,4-dimethylphenyl)-1-phenylprop-2-ynyl] N-cyclohexylcarbamate |
| PubChem CID | 30362 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | [1-(3,4-dimethylphenyl)-1-phenylprop-2-ynyl] N-cyclohexylcarbamate |
| SMILES | C#CC(OC(=O)NC1CCCCC1)(c1ccccc1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C24H27NO2/c1-4-24(20-11-7-5-8-12-20,21-16-15-18(2)19(3)17-21)27-23(26)25-22-13-9-6-10-14-22/h1,5,7-8,11-12,15-17,22H,6,9-10,13-14H2,2-3H3,(H,25,26) |
| InChIKey | GHJUEIFJFIGMDD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(3,4-dimethylphenyl)-1-phenylprop-2-ynyl] N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,4-dimethylphenyl)-1-phenylprop-2-ynyl] N-cyclohexylcarbamate?
The IUPAC name of [1-(3,4-dimethylphenyl)-1-phenylprop-2-ynyl] N-cyclohexylcarbamate (CID 30362) is [1-(3,4-dimethylphenyl)-1-phenylprop-2-ynyl] N-cyclohexylcarbamate.
What is the SMILES notation for [1-(3,4-dimethylphenyl)-1-phenylprop-2-ynyl] N-cyclohexylcarbamate?
The canonical SMILES for [1-(3,4-dimethylphenyl)-1-phenylprop-2-ynyl] N-cyclohexylcarbamate is C#CC(OC(=O)NC1CCCCC1)(c1ccccc1)c1ccc(C)c(C)c1.
What is the InChIKey of [1-(3,4-dimethylphenyl)-1-phenylprop-2-ynyl] N-cyclohexylcarbamate?
The InChIKey is GHJUEIFJFIGMDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27NO2/c1-4-24(20-11-7-5-8-12-20,21-16-15-18(2)19(3)17-21)27-23(26)25-22-13-9-6-10-14-22/h1,5,7-8,11-12,15-17,22H,6,9-10,13-14H2,2-3H3,(H,25,26).
What are the key properties of [1-(3,4-dimethylphenyl)-1-phenylprop-2-ynyl] N-cyclohexylcarbamate?
[1-(3,4-dimethylphenyl)-1-phenylprop-2-ynyl] N-cyclohexylcarbamate has a molecular weight of 361.49 g/mol, XLogP of 5.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,4-dimethylphenyl)-1-phenylprop-2-ynyl] N-cyclohexylcarbamate is sourced from PubChem (CID 30362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).