C18H23N3O4 — CID 30362342
(5S)-5-ethyl-5-(4-methoxyphenyl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)imidazolidine-2,4-dione (PubChem CID 30362342) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is (5S)-5-ethyl-5-(4-methoxyphenyl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-ethyl-5-(4-methoxyphenyl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 30362342 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (5S)-5-ethyl-5-(4-methoxyphenyl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)imidazolidine-2,4-dione |
| SMILES | CC[C@@]1(c2ccc(OC)cc2)NC(=O)N(CC(=O)N2CCCC2)C1=O |
| InChI | InChI=1S/C18H23N3O4/c1-3-18(13-6-8-14(25-2)9-7-13)16(23)21(17(24)19-18)12-15(22)20-10-4-5-11-20/h6-9H,3-5,10-12H2,1-2H3,(H,19,24)/t18-/m0/s1 |
| InChIKey | ONMWHAZXXFRRRA-SFHVURJKSA-N |
| XLogP | 1.47 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|