About ethenylthiourea
ethenylthiourea (PubChem CID 3036306) has the molecular formula C3H6N2S
and a molecular weight of 102.16 g/mol. Its IUPAC name is ethenylthiourea.
Molecular Properties
| Compound Name | ethenylthiourea |
| PubChem CID | 3036306 |
| Molecular Formula | C3H6N2S |
| Molecular Weight | 102.16 g/mol |
| Exact Mass | 102.03 |
| IUPAC Name | ethenylthiourea |
| SMILES | C=CNC(N)=S |
| InChI | InChI=1S/C3H6N2S/c1-2-5-3(4)6/h2H,1H2,(H3,4,5,6) |
| InChIKey | PVTGORQEZYKPDK-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.16 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenylthiourea?
The IUPAC name of ethenylthiourea (CID 3036306) is ethenylthiourea.
What is the SMILES notation for ethenylthiourea?
The canonical SMILES for ethenylthiourea is C=CNC(N)=S.
What is the InChIKey of ethenylthiourea?
The InChIKey is PVTGORQEZYKPDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2S/c1-2-5-3(4)6/h2H,1H2,(H3,4,5,6).
What are the key properties of ethenylthiourea?
ethenylthiourea has a molecular weight of 102.16 g/mol, XLogP of -0.04, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethenylthiourea is sourced from PubChem (CID 3036306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).