C12H24 — CID 3036372
(Z)-2,2,3,4,5,5-hexamethylhex-3-ene (PubChem CID 3036372) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is (Z)-2,2,3,4,5,5-hexamethylhex-3-ene.
| Compound Name | (Z)-2,2,3,4,5,5-hexamethylhex-3-ene |
|---|---|
| PubChem CID | 3036372 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | (Z)-2,2,3,4,5,5-hexamethylhex-3-ene |
| SMILES | C/C(=C(\C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H24/c1-9(11(3,4)5)10(2)12(6,7)8/h1-8H3/b10-9- |
| InChIKey | UKVHFKANOLLXHC-KTKRTIGZSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|