About [(Z)-2,3-dimethyl-4-trimethylsilylbut-2-enyl]-trimethylsilane
[(Z)-2,3-dimethyl-4-trimethylsilylbut-2-enyl]-trimethylsilane (PubChem CID 3036374) has the molecular formula C12H28Si2
and a molecular weight of 228.53 g/mol. Its IUPAC name is [(Z)-2,3-dimethyl-4-trimethylsilylbut-2-enyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(Z)-2,3-dimethyl-4-trimethylsilylbut-2-enyl]-trimethylsilane |
| PubChem CID | 3036374 |
| Molecular Formula | C12H28Si2 |
| Molecular Weight | 228.53 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | [(Z)-2,3-dimethyl-4-trimethylsilylbut-2-enyl]-trimethylsilane |
| SMILES | C/C(C[Si](C)(C)C)=C(\C)C[Si](C)(C)C |
| InChI | InChI=1S/C12H28Si2/c1-11(9-13(3,4)5)12(2)10-14(6,7)8/h9-10H2,1-8H3/b12-11- |
| InChIKey | NWOONZIQJRZSMV-QXMHVHEDSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2,3-dimethyl-4-trimethylsilylbut-2-enyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2,3-dimethyl-4-trimethylsilylbut-2-enyl]-trimethylsilane?
The IUPAC name of [(Z)-2,3-dimethyl-4-trimethylsilylbut-2-enyl]-trimethylsilane (CID 3036374) is [(Z)-2,3-dimethyl-4-trimethylsilylbut-2-enyl]-trimethylsilane.
What is the SMILES notation for [(Z)-2,3-dimethyl-4-trimethylsilylbut-2-enyl]-trimethylsilane?
The canonical SMILES for [(Z)-2,3-dimethyl-4-trimethylsilylbut-2-enyl]-trimethylsilane is C/C(C[Si](C)(C)C)=C(\C)C[Si](C)(C)C.
What is the InChIKey of [(Z)-2,3-dimethyl-4-trimethylsilylbut-2-enyl]-trimethylsilane?
The InChIKey is NWOONZIQJRZSMV-QXMHVHEDSA-N. The full InChI is InChI=1S/C12H28Si2/c1-11(9-13(3,4)5)12(2)10-14(6,7)8/h9-10H2,1-8H3/b12-11-.
What are the key properties of [(Z)-2,3-dimethyl-4-trimethylsilylbut-2-enyl]-trimethylsilane?
[(Z)-2,3-dimethyl-4-trimethylsilylbut-2-enyl]-trimethylsilane has a molecular weight of 228.53 g/mol, XLogP of 5.00, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2,3-dimethyl-4-trimethylsilylbut-2-enyl]-trimethylsilane is sourced from PubChem (CID 3036374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).