C27H32N4O — CID 30363843
N-(4-butylphenyl)-1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-4-carboxamide (PubChem CID 30363843) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is N-(4-butylphenyl)-1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-4-carboxamide.
| Compound Name | N-(4-butylphenyl)-1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30363843 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | N-(4-butylphenyl)-1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-4-carboxamide |
| SMILES | CCCCc1ccc(NC(=O)C2CCN(c3ccc(-c4ccccc4C)nn3)CC2)cc1 |
| InChI | InChI=1S/C27H32N4O/c1-3-4-8-21-10-12-23(13-11-21)28-27(32)22-16-18-31(19-17-22)26-15-14-25(29-30-26)24-9-6-5-7-20(24)2/h5-7,9-15,22H,3-4,8,16-19H2,1-2H3,(H,28,32) |
| InChIKey | NPTYZFYHZIHRLG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |