About 4-methyldibenzothiophene
4-methyldibenzothiophene (PubChem CID 30364) has the molecular formula C13H10S
and a molecular weight of 198.29 g/mol. Its IUPAC name is 4-methyldibenzothiophene.
Molecular Properties
| Compound Name | 4-methyldibenzothiophene |
| PubChem CID | 30364 |
| Molecular Formula | C13H10S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 4-methyldibenzothiophene |
| SMILES | Cc1cccc2c1sc1ccccc12 |
| InChI | InChI=1S/C13H10S/c1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11/h2-8H,1H3 |
| InChIKey | NICUQYHIOMMFGV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyldibenzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyldibenzothiophene?
The IUPAC name of 4-methyldibenzothiophene (CID 30364) is 4-methyldibenzothiophene.
What is the SMILES notation for 4-methyldibenzothiophene?
The canonical SMILES for 4-methyldibenzothiophene is Cc1cccc2c1sc1ccccc12.
What is the InChIKey of 4-methyldibenzothiophene?
The InChIKey is NICUQYHIOMMFGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10S/c1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11/h2-8H,1H3.
What are the key properties of 4-methyldibenzothiophene?
4-methyldibenzothiophene has a molecular weight of 198.29 g/mol, XLogP of 4.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyldibenzothiophene is sourced from PubChem (CID 30364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).