C8H9Cl5S — CID 3036424
(1E)-1-tert-butylsulfanyl-1,2,3,4,4-pentachlorobuta-1,3-diene (PubChem CID 3036424) has the molecular formula C8H9Cl5S and a molecular weight of 314.49 g/mol. Its IUPAC name is (1E)-1-tert-butylsulfanyl-1,2,3,4,4-pentachlorobuta-1,3-diene.
| Compound Name | (1E)-1-tert-butylsulfanyl-1,2,3,4,4-pentachlorobuta-1,3-diene |
|---|---|
| PubChem CID | 3036424 |
| Molecular Formula | C8H9Cl5S |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 311.89 |
| IUPAC Name | (1E)-1-tert-butylsulfanyl-1,2,3,4,4-pentachlorobuta-1,3-diene |
| SMILES | CC(C)(C)S/C(Cl)=C(\Cl)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C8H9Cl5S/c1-8(2,3)14-7(13)5(10)4(9)6(11)12/h1-3H3/b7-5- |
| InChIKey | QYQSJXCKVHEKHH-ALCCZGGFSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|