About 2-(hydroxyamino)-3,7-dihydropurine-6-thione
2-(hydroxyamino)-3,7-dihydropurine-6-thione (PubChem CID 3036492) has the molecular formula C5H5N5OS
and a molecular weight of 183.20 g/mol. Its IUPAC name is 2-(hydroxyamino)-3,7-dihydropurine-6-thione.
Molecular Properties
| Compound Name | 2-(hydroxyamino)-3,7-dihydropurine-6-thione |
| PubChem CID | 3036492 |
| Molecular Formula | C5H5N5OS |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 2-(hydroxyamino)-3,7-dihydropurine-6-thione |
| SMILES | ONc1nc(=S)c2[nH]cnc2[nH]1 |
| InChI | InChI=1S/C5H5N5OS/c11-10-5-8-3-2(4(12)9-5)6-1-7-3/h1,11H,(H3,6,7,8,9,10,12) |
| InChIKey | KKRAGNQZMCYCHW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxyamino)-3,7-dihydropurine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxyamino)-3,7-dihydropurine-6-thione?
The IUPAC name of 2-(hydroxyamino)-3,7-dihydropurine-6-thione (CID 3036492) is 2-(hydroxyamino)-3,7-dihydropurine-6-thione.
What is the SMILES notation for 2-(hydroxyamino)-3,7-dihydropurine-6-thione?
The canonical SMILES for 2-(hydroxyamino)-3,7-dihydropurine-6-thione is ONc1nc(=S)c2[nH]cnc2[nH]1.
What is the InChIKey of 2-(hydroxyamino)-3,7-dihydropurine-6-thione?
The InChIKey is KKRAGNQZMCYCHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5OS/c11-10-5-8-3-2(4(12)9-5)6-1-7-3/h1,11H,(H3,6,7,8,9,10,12).
What are the key properties of 2-(hydroxyamino)-3,7-dihydropurine-6-thione?
2-(hydroxyamino)-3,7-dihydropurine-6-thione has a molecular weight of 183.20 g/mol, XLogP of 0.82, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxyamino)-3,7-dihydropurine-6-thione is sourced from PubChem (CID 3036492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).