C24H23ClO2 — CID 3036505
2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethanol (PubChem CID 3036505) has the molecular formula C24H23ClO2 and a molecular weight of 378.90 g/mol. Its IUPAC name is 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethanol.
| Compound Name | 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 3036505 |
| Molecular Formula | C24H23ClO2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethanol |
| SMILES | OCCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23ClO2/c25-16-15-23(19-7-3-1-4-8-19)24(20-9-5-2-6-10-20)21-11-13-22(14-12-21)27-18-17-26/h1-14,26H,15-18H2/b24-23- |
| InChIKey | LUMKNAVTFCDUIE-VHXPQNKSSA-N |
| XLogP | 5.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|