C11H9N3O2S — CID 3036674
(3,4-dihydroxynaphthalen-1-yl)iminothiourea (PubChem CID 3036674) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is (3,4-dihydroxynaphthalen-1-yl)iminothiourea.
| Compound Name | (3,4-dihydroxynaphthalen-1-yl)iminothiourea |
|---|---|
| PubChem CID | 3036674 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | (3,4-dihydroxynaphthalen-1-yl)iminothiourea |
| SMILES | NC(=S)/N=N/c1cc(O)c(O)c2ccccc12 |
| InChI | InChI=1S/C11H9N3O2S/c12-11(17)14-13-8-5-9(15)10(16)7-4-2-1-3-6(7)8/h1-5,15-16H,(H2,12,17)/b14-13+ |
| InChIKey | DGWCRYGBSXJMNR-BUHFOSPRSA-N |
| XLogP | 2.58 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|