C21H15NO3 — CID 3036728
(16S,18R,19R,20S)-17-oxa-13-azahexacyclo[12.9.0.03,12.04,9.015,21.016,18]tricosa-1,3(12),4,6,8,10,13,15(21),22-nonaene-19,20-diol (PubChem CID 3036728) has the molecular formula C21H15NO3 and a molecular weight of 329.36 g/mol. Its IUPAC name is (16S,18R,19R,20S)-17-oxa-13-azahexacyclo[12.9.0.03,12.04,9.015,21.016,18]tricosa-1,3(12),4,6,8,10,13,15(21),22-nonaene-19,20-diol.
| Compound Name | (16S,18R,19R,20S)-17-oxa-13-azahexacyclo[12.9.0.03,12.04,9.015,21.016,18]tricosa-1,3(12),4,6,8,10,13,15(21),22-nonaene-19,20-diol |
|---|---|
| PubChem CID | 3036728 |
| Molecular Formula | C21H15NO3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (16S,18R,19R,20S)-17-oxa-13-azahexacyclo[12.9.0.03,12.04,9.015,21.016,18]tricosa-1,3(12),4,6,8,10,13,15(21),22-nonaene-19,20-diol |
| SMILES | O[C@H]1[C@H]2O[C@H]2c2c(ccc3cc4c(ccc5ccccc54)nc23)[C@@H]1O |
| InChI | InChI=1S/C21H15NO3/c23-18-13-7-5-11-9-14-12-4-2-1-3-10(12)6-8-15(14)22-17(11)16(13)20-21(25-20)19(18)24/h1-9,18-21,23-24H/t18-,19+,20-,21+/m0/s1 |
| InChIKey | YDXYXYWIDOQJHT-JSXRDJHFSA-N |
| XLogP | 3.39 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|