C18H23ClMnN3O3S4- — CID 3036788
2-chloro-N-(2,6-dimethylphenyl)-N-(2-oxooxolan-3-yl)acetamide;N-[2-(disulfidomethylamino)ethyl]carbamodithioate;manganese(2+) (PubChem CID 3036788) has the molecular formula C18H23ClMnN3O3S4- and a molecular weight of 548.06 g/mol. Its IUPAC name is 2-chloro-N-(2,6-dimethylphenyl)-N-(2-oxooxolan-3-yl)acetamide;N-[2-(disulfidomethylamino)ethyl]carbamodithioate;manganese(2+).
| Compound Name | 2-chloro-N-(2,6-dimethylphenyl)-N-(2-oxooxolan-3-yl)acetamide;N-[2-(disulfidomethylamino)ethyl]carbamodithioate;manganese(2+) |
|---|---|
| PubChem CID | 3036788 |
| Molecular Formula | C18H23ClMnN3O3S4- |
| Molecular Weight | 548.06 g/mol |
| Exact Mass | 546.97 |
| IUPAC Name | 2-chloro-N-(2,6-dimethylphenyl)-N-(2-oxooxolan-3-yl)acetamide;N-[2-(disulfidomethylamino)ethyl]carbamodithioate;manganese(2+) |
| SMILES | Cc1cccc(C)c1N(C(=O)CCl)C1CCOC1=O.S=C([S-])NCCNC([S-])[S-].[Mn+2] |
| InChI | InChI=1S/C14H16ClNO3.C4H10N2S4.Mn/c1-9-4-3-5-10(2)13(9)16(12(17)8-15)11-6-7-19-14(11)18;7-3(8)5-1-2-6-4(9)10;/h3-5,11H,6-8H2,1-2H3;3,5,7-8H,1-2H2,(H2,6,9,10);/q;;+2/p-3 |
| InChIKey | VXJDZZKFXPCEOA-UHFFFAOYSA-K |
| XLogP | 1.56 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.06 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|