C13H12O5 — CID 3036800
(3E,3aR,6aR)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-4,6a-dihydro-3aH-cyclopenta[b]furan-2-one (PubChem CID 3036800) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is (3E,3aR,6aR)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-4,6a-dihydro-3aH-cyclopenta[b]furan-2-one.
| Compound Name | (3E,3aR,6aR)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-4,6a-dihydro-3aH-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 3036800 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (3E,3aR,6aR)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-4,6a-dihydro-3aH-cyclopenta[b]furan-2-one |
| SMILES | CC1=CC(O/C=C2/C(=O)O[C@@H]3C=CC[C@H]23)OC1=O |
| InChI | InChI=1S/C13H12O5/c1-7-5-11(18-12(7)14)16-6-9-8-3-2-4-10(8)17-13(9)15/h2,4-6,8,10-11H,3H2,1H3/b9-6+/t8-,10-,11?/m1/s1 |
| InChIKey | BRUYQMXQRFVVMG-IBNACCKNSA-N |
| XLogP | 1.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|