About 3H-1,3-benzothiazole-2-thione;N-ethylethanamine
3H-1,3-benzothiazole-2-thione;N-ethylethanamine (PubChem CID 3036970) has the molecular formula C11H16N2S2
and a molecular weight of 240.40 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;N-ethylethanamine.
Molecular Properties
| Compound Name | 3H-1,3-benzothiazole-2-thione;N-ethylethanamine |
| PubChem CID | 3036970 |
| Molecular Formula | C11H16N2S2 |
| Molecular Weight | 240.40 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;N-ethylethanamine |
| SMILES | CCNCC.S=c1[nH]c2ccccc2s1 |
| InChI | InChI=1S/C7H5NS2.C4H11N/c9-7-8-5-3-1-2-4-6(5)10-7;1-3-5-4-2/h1-4H,(H,8,9);5H,3-4H2,1-2H3 |
| InChIKey | KBGASPZQKDYDDG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3H-1,3-benzothiazole-2-thione;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1,3-benzothiazole-2-thione;N-ethylethanamine?
The IUPAC name of 3H-1,3-benzothiazole-2-thione;N-ethylethanamine (CID 3036970) is 3H-1,3-benzothiazole-2-thione;N-ethylethanamine.
What is the SMILES notation for 3H-1,3-benzothiazole-2-thione;N-ethylethanamine?
The canonical SMILES for 3H-1,3-benzothiazole-2-thione;N-ethylethanamine is CCNCC.S=c1[nH]c2ccccc2s1.
What is the InChIKey of 3H-1,3-benzothiazole-2-thione;N-ethylethanamine?
The InChIKey is KBGASPZQKDYDDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS2.C4H11N/c9-7-8-5-3-1-2-4-6(5)10-7;1-3-5-4-2/h1-4H,(H,8,9);5H,3-4H2,1-2H3.
What are the key properties of 3H-1,3-benzothiazole-2-thione;N-ethylethanamine?
3H-1,3-benzothiazole-2-thione;N-ethylethanamine has a molecular weight of 240.40 g/mol, XLogP of 3.57, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1,3-benzothiazole-2-thione;N-ethylethanamine is sourced from PubChem (CID 3036970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).