C26H24N6O2 — CID 3036997
1-N,2-N-bis[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]benzene-1,2-dicarboxamide (PubChem CID 3036997) has the molecular formula C26H24N6O2 and a molecular weight of 452.52 g/mol. Its IUPAC name is 1-N,2-N-bis[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]benzene-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-bis[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 3036997 |
| Molecular Formula | C26H24N6O2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 1-N,2-N-bis[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]benzene-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccc(C2=NCCN2)cc1)c1ccccc1C(=O)Nc1ccc(C2=NCCN2)cc1 |
| InChI | InChI=1S/C26H24N6O2/c33-25(31-19-9-5-17(6-10-19)23-27-13-14-28-23)21-3-1-2-4-22(21)26(34)32-20-11-7-18(8-12-20)24-29-15-16-30-24/h1-12H,13-16H2,(H,27,28)(H,29,30)(H,31,33)(H,32,34) |
| InChIKey | YLSZUMYICQWCKS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |