About methanamine;methylcarbamodithioic acid
methanamine;methylcarbamodithioic acid (PubChem CID 3037097) has the molecular formula C3H10N2S2
and a molecular weight of 138.26 g/mol. Its IUPAC name is methanamine;methylcarbamodithioic acid.
Molecular Properties
| Compound Name | methanamine;methylcarbamodithioic acid |
| PubChem CID | 3037097 |
| Molecular Formula | C3H10N2S2 |
| Molecular Weight | 138.26 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | methanamine;methylcarbamodithioic acid |
| SMILES | CN.CNC(=S)S |
| InChI | InChI=1S/C2H5NS2.CH5N/c1-3-2(4)5;1-2/h1H3,(H2,3,4,5);2H2,1H3 |
| InChIKey | CLNJKWUFFSDNLL-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.26 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanamine;methylcarbamodithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;methylcarbamodithioic acid?
The IUPAC name of methanamine;methylcarbamodithioic acid (CID 3037097) is methanamine;methylcarbamodithioic acid.
What is the SMILES notation for methanamine;methylcarbamodithioic acid?
The canonical SMILES for methanamine;methylcarbamodithioic acid is CN.CNC(=S)S.
What is the InChIKey of methanamine;methylcarbamodithioic acid?
The InChIKey is CLNJKWUFFSDNLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NS2.CH5N/c1-3-2(4)5;1-2/h1H3,(H2,3,4,5);2H2,1H3.
What are the key properties of methanamine;methylcarbamodithioic acid?
methanamine;methylcarbamodithioic acid has a molecular weight of 138.26 g/mol, XLogP of -0.00, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;methylcarbamodithioic acid is sourced from PubChem (CID 3037097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).