About 2-methyl-3,7-dihydropurine-6-thione
2-methyl-3,7-dihydropurine-6-thione (PubChem CID 3037429) has the molecular formula C6H6N4S
and a molecular weight of 166.21 g/mol. Its IUPAC name is 2-methyl-3,7-dihydropurine-6-thione.
Molecular Properties
| Compound Name | 2-methyl-3,7-dihydropurine-6-thione |
| PubChem CID | 3037429 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 2-methyl-3,7-dihydropurine-6-thione |
| SMILES | Cc1nc(=S)c2[nH]cnc2[nH]1 |
| InChI | InChI=1S/C6H6N4S/c1-3-9-5-4(6(11)10-3)7-2-8-5/h2H,1H3,(H2,7,8,9,10,11) |
| InChIKey | YWQVHMHIKOYWHQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3,7-dihydropurine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,7-dihydropurine-6-thione?
The IUPAC name of 2-methyl-3,7-dihydropurine-6-thione (CID 3037429) is 2-methyl-3,7-dihydropurine-6-thione.
What is the SMILES notation for 2-methyl-3,7-dihydropurine-6-thione?
The canonical SMILES for 2-methyl-3,7-dihydropurine-6-thione is Cc1nc(=S)c2[nH]cnc2[nH]1.
What is the InChIKey of 2-methyl-3,7-dihydropurine-6-thione?
The InChIKey is YWQVHMHIKOYWHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4S/c1-3-9-5-4(6(11)10-3)7-2-8-5/h2H,1H3,(H2,7,8,9,10,11).
What are the key properties of 2-methyl-3,7-dihydropurine-6-thione?
2-methyl-3,7-dihydropurine-6-thione has a molecular weight of 166.21 g/mol, XLogP of 1.32, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,7-dihydropurine-6-thione is sourced from PubChem (CID 3037429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).