About (1-ethylpiperidin-3-yl)methyl N-(2,6-dimethylphenyl)carbamate
(1-ethylpiperidin-3-yl)methyl N-(2,6-dimethylphenyl)carbamate (PubChem CID 30375) has the molecular formula C17H26N2O2
and a molecular weight of 290.41 g/mol. Its IUPAC name is (1-ethylpiperidin-3-yl)methyl N-(2,6-dimethylphenyl)carbamate.
Molecular Properties
| Compound Name | (1-ethylpiperidin-3-yl)methyl N-(2,6-dimethylphenyl)carbamate |
| PubChem CID | 30375 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (1-ethylpiperidin-3-yl)methyl N-(2,6-dimethylphenyl)carbamate |
| SMILES | CCN1CCCC(COC(=O)Nc2c(C)cccc2C)C1 |
| InChI | InChI=1S/C17H26N2O2/c1-4-19-10-6-9-15(11-19)12-21-17(20)18-16-13(2)7-5-8-14(16)3/h5,7-8,15H,4,6,9-12H2,1-3H3,(H,18,20) |
| InChIKey | VEEVSPGMKRPCSV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-ethylpiperidin-3-yl)methyl N-(2,6-dimethylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylpiperidin-3-yl)methyl N-(2,6-dimethylphenyl)carbamate?
The IUPAC name of (1-ethylpiperidin-3-yl)methyl N-(2,6-dimethylphenyl)carbamate (CID 30375) is (1-ethylpiperidin-3-yl)methyl N-(2,6-dimethylphenyl)carbamate.
What is the SMILES notation for (1-ethylpiperidin-3-yl)methyl N-(2,6-dimethylphenyl)carbamate?
The canonical SMILES for (1-ethylpiperidin-3-yl)methyl N-(2,6-dimethylphenyl)carbamate is CCN1CCCC(COC(=O)Nc2c(C)cccc2C)C1.
What is the InChIKey of (1-ethylpiperidin-3-yl)methyl N-(2,6-dimethylphenyl)carbamate?
The InChIKey is VEEVSPGMKRPCSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2/c1-4-19-10-6-9-15(11-19)12-21-17(20)18-16-13(2)7-5-8-14(16)3/h5,7-8,15H,4,6,9-12H2,1-3H3,(H,18,20).
What are the key properties of (1-ethylpiperidin-3-yl)methyl N-(2,6-dimethylphenyl)carbamate?
(1-ethylpiperidin-3-yl)methyl N-(2,6-dimethylphenyl)carbamate has a molecular weight of 290.41 g/mol, XLogP of 3.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylpiperidin-3-yl)methyl N-(2,6-dimethylphenyl)carbamate is sourced from PubChem (CID 30375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).