C20H34N4OS — CID 30376724
N-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-yl)-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 30376724) has the molecular formula C20H34N4OS and a molecular weight of 378.59 g/mol. Its IUPAC name is N-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-yl)-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-yl)-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 30376724 |
| Molecular Formula | C20H34N4OS |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | N-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-yl)-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | CN1CCN(CC(=O)Nc2nc3c(s2)CCCCCCCCCC3)CC1 |
| InChI | InChI=1S/C20H34N4OS/c1-23-12-14-24(15-13-23)16-19(25)22-20-21-17-10-8-6-4-2-3-5-7-9-11-18(17)26-20/h2-16H2,1H3,(H,21,22,25) |
| InChIKey | GHDGDHHCICIRDC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |