C18H37N3S3 — CID 3037708
1-[(8Z)-1,7-bis(2-methyl-2-sulfanylpropyl)-2,3,5,6-tetrahydro-1,4,7-triazonin-4-yl]-2-methylpropane-2-thiol (PubChem CID 3037708) has the molecular formula C18H37N3S3 and a molecular weight of 391.72 g/mol. Its IUPAC name is 1-[(8Z)-1,7-bis(2-methyl-2-sulfanylpropyl)-2,3,5,6-tetrahydro-1,4,7-triazonin-4-yl]-2-methylpropane-2-thiol.
| Compound Name | 1-[(8Z)-1,7-bis(2-methyl-2-sulfanylpropyl)-2,3,5,6-tetrahydro-1,4,7-triazonin-4-yl]-2-methylpropane-2-thiol |
|---|---|
| PubChem CID | 3037708 |
| Molecular Formula | C18H37N3S3 |
| Molecular Weight | 391.72 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 1-[(8Z)-1,7-bis(2-methyl-2-sulfanylpropyl)-2,3,5,6-tetrahydro-1,4,7-triazonin-4-yl]-2-methylpropane-2-thiol |
| SMILES | CC(C)(S)CN1/C=C\N(CC(C)(C)S)CCN(CC(C)(C)S)CC1 |
| InChI | InChI=1S/C18H37N3S3/c1-16(2,22)13-19-7-9-20(14-17(3,4)23)11-12-21(10-8-19)15-18(5,6)24/h7,9,22-24H,8,10-15H2,1-6H3/b9-7- |
| InChIKey | XMQSRTKNEZURPE-CLFYSBASSA-N |
| XLogP | 3.50 |
| TPSA | 9.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.72 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|