C25H30ClN3OS — CID 30377080
2-[(4-chloronaphthalen-1-yl)amino]-N-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-yl)acetamide (PubChem CID 30377080) has the molecular formula C25H30ClN3OS and a molecular weight of 456.06 g/mol. Its IUPAC name is 2-[(4-chloronaphthalen-1-yl)amino]-N-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-yl)acetamide.
| Compound Name | 2-[(4-chloronaphthalen-1-yl)amino]-N-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 30377080 |
| Molecular Formula | C25H30ClN3OS |
| Molecular Weight | 456.06 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 2-[(4-chloronaphthalen-1-yl)amino]-N-(4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazol-2-yl)acetamide |
| SMILES | O=C(CNc1ccc(Cl)c2ccccc12)Nc1nc2c(s1)CCCCCCCCCC2 |
| InChI | InChI=1S/C25H30ClN3OS/c26-20-15-16-21(19-12-10-9-11-18(19)20)27-17-24(30)29-25-28-22-13-7-5-3-1-2-4-6-8-14-23(22)31-25/h9-12,15-16,27H,1-8,13-14,17H2,(H,28,29,30) |
| InChIKey | ZMJZQXGYSYWNMH-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.06 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |