C20H20O7 — CID 3037799
(1R,13R,15Z)-15-ethyl-18,18-dihydroxy-16-methyl-14,17-dioxatetracyclo[11.3.3.02,11.04,9]nonadeca-4(9),6,10,15-tetraene-3,5,8-trione (PubChem CID 3037799) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is (1R,13R,15Z)-15-ethyl-18,18-dihydroxy-16-methyl-14,17-dioxatetracyclo[11.3.3.02,11.04,9]nonadeca-4(9),6,10,15-tetraene-3,5,8-trione.
| Compound Name | (1R,13R,15Z)-15-ethyl-18,18-dihydroxy-16-methyl-14,17-dioxatetracyclo[11.3.3.02,11.04,9]nonadeca-4(9),6,10,15-tetraene-3,5,8-trione |
|---|---|
| PubChem CID | 3037799 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (1R,13R,15Z)-15-ethyl-18,18-dihydroxy-16-methyl-14,17-dioxatetracyclo[11.3.3.02,11.04,9]nonadeca-4(9),6,10,15-tetraene-3,5,8-trione |
| SMILES | CC/C1=C(\C)[C@@H]2OC(O)(O)C[C@@H](CC3=CC4=C(C(=O)C=CC4=O)C(=O)C32)O1 |
| InChI | InChI=1S/C20H20O7/c1-3-15-9(2)19-16-10(6-11(26-15)8-20(24,25)27-19)7-12-13(21)4-5-14(22)17(12)18(16)23/h4-5,7,11,16,19,24-25H,3,6,8H2,1-2H3/b15-9-/t11-,16?,19+/m1/s1 |
| InChIKey | CQKOKBLBQRAHGE-JBHMWPDKSA-N |
| XLogP | 1.02 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|