C23H20N4O3S — CID 30378303
3-(benzenesulfonamido)-N-[(4-imidazol-1-ylphenyl)methyl]benzamide (PubChem CID 30378303) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[(4-imidazol-1-ylphenyl)methyl]benzamide.
| Compound Name | 3-(benzenesulfonamido)-N-[(4-imidazol-1-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 30378303 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[(4-imidazol-1-ylphenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(-n2ccnc2)cc1)c1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H20N4O3S/c28-23(25-16-18-9-11-21(12-10-18)27-14-13-24-17-27)19-5-4-6-20(15-19)26-31(29,30)22-7-2-1-3-8-22/h1-15,17,26H,16H2,(H,25,28) |
| InChIKey | MRZZYRLHJCAAIN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |