C22H25N3O3 — CID 30378635
1-benzyl-3-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-7-yl)urea (PubChem CID 30378635) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-benzyl-3-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-7-yl)urea.
| Compound Name | 1-benzyl-3-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-7-yl)urea |
|---|---|
| PubChem CID | 30378635 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-benzyl-3-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-7-yl)urea |
| SMILES | C=CCN1C(=O)C(C)(C)COc2ccc(NC(=O)NCc3ccccc3)cc21 |
| InChI | InChI=1S/C22H25N3O3/c1-4-12-25-18-13-17(10-11-19(18)28-15-22(2,3)20(25)26)24-21(27)23-14-16-8-6-5-7-9-16/h4-11,13H,1,12,14-15H2,2-3H3,(H2,23,24,27) |
| InChIKey | OCEIXEVPXKXHNF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|