C9H8Cl2N4OS — CID 3037944
4-amino-3-[(2,4-dichlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 3037944) has the molecular formula C9H8Cl2N4OS and a molecular weight of 291.16 g/mol. Its IUPAC name is 4-amino-3-[(2,4-dichlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-[(2,4-dichlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 3037944 |
| Molecular Formula | C9H8Cl2N4OS |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 4-amino-3-[(2,4-dichlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Nn1c(COc2ccc(Cl)cc2Cl)n[nH]c1=S |
| InChI | InChI=1S/C9H8Cl2N4OS/c10-5-1-2-7(6(11)3-5)16-4-8-13-14-9(17)15(8)12/h1-3H,4,12H2,(H,14,17) |
| InChIKey | QESGKBGZPADFHW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 68.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|