C33H24BrN3O3 — CID 3037962
(10Z)-2-bromo-8-(hydroxy-phenyl-pyridin-2-ylmethyl)-10-[phenyl(pyridin-2-yl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 3037962) has the molecular formula C33H24BrN3O3 and a molecular weight of 590.48 g/mol. Its IUPAC name is (10Z)-2-bromo-8-(hydroxy-phenyl-pyridin-2-ylmethyl)-10-[phenyl(pyridin-2-yl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (10Z)-2-bromo-8-(hydroxy-phenyl-pyridin-2-ylmethyl)-10-[phenyl(pyridin-2-yl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 3037962 |
| Molecular Formula | C33H24BrN3O3 |
| Molecular Weight | 590.48 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | (10Z)-2-bromo-8-(hydroxy-phenyl-pyridin-2-ylmethyl)-10-[phenyl(pyridin-2-yl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1NC(=O)C2(Br)C3C=C(C(O)(c4ccccc4)c4ccccn4)C(/C3=C(\c3ccccc3)c3ccccn3)C12 |
| InChI | InChI=1S/C33H24BrN3O3/c34-32-22-19-23(33(40,21-13-5-2-6-14-21)25-16-8-10-18-36-25)28(29(32)30(38)37-31(32)39)27(22)26(20-11-3-1-4-12-20)24-15-7-9-17-35-24/h1-19,22,28-29,40H,(H,37,38,39)/b27-26+ |
| InChIKey | RAEZGSPQPBJJRV-CYYJNZCTSA-N |
| XLogP | 4.81 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|