C11H8ClN3O3S — CID 3038011
N-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinane-5-carbothioamide (PubChem CID 3038011) has the molecular formula C11H8ClN3O3S and a molecular weight of 297.72 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinane-5-carbothioamide.
| Compound Name | N-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinane-5-carbothioamide |
|---|---|
| PubChem CID | 3038011 |
| Molecular Formula | C11H8ClN3O3S |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | N-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinane-5-carbothioamide |
| SMILES | O=C1NC(=O)C(C(=S)Nc2ccc(Cl)cc2)C(=O)N1 |
| InChI | InChI=1S/C11H8ClN3O3S/c12-5-1-3-6(4-2-5)13-10(19)7-8(16)14-11(18)15-9(7)17/h1-4,7H,(H,13,19)(H2,14,15,16,17,18) |
| InChIKey | ZTGKPAZXLZBQMO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|