About 3-benzyl-4,6,6-trimethyl-1H-pyrimidine-2-thione
3-benzyl-4,6,6-trimethyl-1H-pyrimidine-2-thione (PubChem CID 3038157) has the molecular formula C14H18N2S
and a molecular weight of 246.38 g/mol. Its IUPAC name is 3-benzyl-4,6,6-trimethyl-1H-pyrimidine-2-thione.
Molecular Properties
| Compound Name | 3-benzyl-4,6,6-trimethyl-1H-pyrimidine-2-thione |
| PubChem CID | 3038157 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-benzyl-4,6,6-trimethyl-1H-pyrimidine-2-thione |
| SMILES | CC1=CC(C)(C)NC(=S)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H18N2S/c1-11-9-14(2,3)15-13(17)16(11)10-12-7-5-4-6-8-12/h4-9H,10H2,1-3H3,(H,15,17) |
| InChIKey | VPLAWQQORNUSTM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-4,6,6-trimethyl-1H-pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-4,6,6-trimethyl-1H-pyrimidine-2-thione?
The IUPAC name of 3-benzyl-4,6,6-trimethyl-1H-pyrimidine-2-thione (CID 3038157) is 3-benzyl-4,6,6-trimethyl-1H-pyrimidine-2-thione.
What is the SMILES notation for 3-benzyl-4,6,6-trimethyl-1H-pyrimidine-2-thione?
The canonical SMILES for 3-benzyl-4,6,6-trimethyl-1H-pyrimidine-2-thione is CC1=CC(C)(C)NC(=S)N1Cc1ccccc1.
What is the InChIKey of 3-benzyl-4,6,6-trimethyl-1H-pyrimidine-2-thione?
The InChIKey is VPLAWQQORNUSTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2S/c1-11-9-14(2,3)15-13(17)16(11)10-12-7-5-4-6-8-12/h4-9H,10H2,1-3H3,(H,15,17).
What are the key properties of 3-benzyl-4,6,6-trimethyl-1H-pyrimidine-2-thione?
3-benzyl-4,6,6-trimethyl-1H-pyrimidine-2-thione has a molecular weight of 246.38 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-4,6,6-trimethyl-1H-pyrimidine-2-thione is sourced from PubChem (CID 3038157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).