About 3-prop-2-enyl-1,1-bis[2-(prop-2-enylcarbamothioylamino)ethyl]thiourea
3-prop-2-enyl-1,1-bis[2-(prop-2-enylcarbamothioylamino)ethyl]thiourea (PubChem CID 3038228) has the molecular formula C16H28N6S3
and a molecular weight of 400.64 g/mol. Its IUPAC name is 3-prop-2-enyl-1,1-bis[2-(prop-2-enylcarbamothioylamino)ethyl]thiourea.
Molecular Properties
| Compound Name | 3-prop-2-enyl-1,1-bis[2-(prop-2-enylcarbamothioylamino)ethyl]thiourea |
| PubChem CID | 3038228 |
| Molecular Formula | C16H28N6S3 |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 3-prop-2-enyl-1,1-bis[2-(prop-2-enylcarbamothioylamino)ethyl]thiourea |
| SMILES | C=CCNC(=S)NCCN(CCNC(=S)NCC=C)C(=S)NCC=C |
| InChI | InChI=1S/C16H28N6S3/c1-4-7-17-14(23)19-10-12-22(16(25)21-9-6-3)13-11-20-15(24)18-8-5-2/h4-6H,1-3,7-13H2,(H,21,25)(H2,17,19,23)(H2,18,20,24) |
| InChIKey | IEYATMTTWRPNMI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 63.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enyl-1,1-bis[2-(prop-2-enylcarbamothioylamino)ethyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enyl-1,1-bis[2-(prop-2-enylcarbamothioylamino)ethyl]thiourea?
The IUPAC name of 3-prop-2-enyl-1,1-bis[2-(prop-2-enylcarbamothioylamino)ethyl]thiourea (CID 3038228) is 3-prop-2-enyl-1,1-bis[2-(prop-2-enylcarbamothioylamino)ethyl]thiourea.
What is the SMILES notation for 3-prop-2-enyl-1,1-bis[2-(prop-2-enylcarbamothioylamino)ethyl]thiourea?
The canonical SMILES for 3-prop-2-enyl-1,1-bis[2-(prop-2-enylcarbamothioylamino)ethyl]thiourea is C=CCNC(=S)NCCN(CCNC(=S)NCC=C)C(=S)NCC=C.
What is the InChIKey of 3-prop-2-enyl-1,1-bis[2-(prop-2-enylcarbamothioylamino)ethyl]thiourea?
The InChIKey is IEYATMTTWRPNMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N6S3/c1-4-7-17-14(23)19-10-12-22(16(25)21-9-6-3)13-11-20-15(24)18-8-5-2/h4-6H,1-3,7-13H2,(H,21,25)(H2,17,19,23)(H2,18,20,24).
What are the key properties of 3-prop-2-enyl-1,1-bis[2-(prop-2-enylcarbamothioylamino)ethyl]thiourea?
3-prop-2-enyl-1,1-bis[2-(prop-2-enylcarbamothioylamino)ethyl]thiourea has a molecular weight of 400.64 g/mol, XLogP of 0.65, 12 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enyl-1,1-bis[2-(prop-2-enylcarbamothioylamino)ethyl]thiourea is sourced from PubChem (CID 3038228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).