C21H24N2O2 — CID 3038398
[(3aR,8bS)-3-ethyl-8b-methyl-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrol-7-yl] N-phenylcarbamate (PubChem CID 3038398) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is [(3aR,8bS)-3-ethyl-8b-methyl-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrol-7-yl] N-phenylcarbamate.
| Compound Name | [(3aR,8bS)-3-ethyl-8b-methyl-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrol-7-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 3038398 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [(3aR,8bS)-3-ethyl-8b-methyl-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrol-7-yl] N-phenylcarbamate |
| SMILES | CCN1CC[C@@]2(C)c3cc(OC(=O)Nc4ccccc4)ccc3C[C@@H]12 |
| InChI | InChI=1S/C21H24N2O2/c1-3-23-12-11-21(2)18-14-17(10-9-15(18)13-19(21)23)25-20(24)22-16-7-5-4-6-8-16/h4-10,14,19H,3,11-13H2,1-2H3,(H,22,24)/t19-,21+/m1/s1 |
| InChIKey | TXJSVDRPBGRIFY-CTNGQTDRSA-N |
| XLogP | 4.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |